C8H13N7O2 — CID 67801467
2-[(2-amino-6-hydrazinylpurin-9-yl)methoxy]ethanol (PubChem CID 67801467) has the molecular formula C8H13N7O2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-[(2-amino-6-hydrazinylpurin-9-yl)methoxy]ethanol.
| Compound Name | 2-[(2-amino-6-hydrazinylpurin-9-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 67801467 |
| Molecular Formula | C8H13N7O2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(2-amino-6-hydrazinylpurin-9-yl)methoxy]ethanol |
| SMILES | NNc1nc(N)nc2c1ncn2COCCO |
| InChI | InChI=1S/C8H13N7O2/c9-8-12-6(14-10)5-7(13-8)15(3-11-5)4-17-2-1-16/h3,16H,1-2,4,10H2,(H3,9,12,13,14) |
| InChIKey | RYGKPBQWBGLTBM-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|