C9H14N6O3 — CID 143717485
(2S)-2-[(2,6-diaminopurin-9-yl)methoxy]-2-methoxyethanol (PubChem CID 143717485) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is (2S)-2-[(2,6-diaminopurin-9-yl)methoxy]-2-methoxyethanol.
| Compound Name | (2S)-2-[(2,6-diaminopurin-9-yl)methoxy]-2-methoxyethanol |
|---|---|
| PubChem CID | 143717485 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S)-2-[(2,6-diaminopurin-9-yl)methoxy]-2-methoxyethanol |
| SMILES | CO[C@H](CO)OCn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C9H14N6O3/c1-17-5(2-16)18-4-15-3-12-6-7(10)13-9(11)14-8(6)15/h3,5,16H,2,4H2,1H3,(H4,10,11,13,14)/t5-/m0/s1 |
| InChIKey | VCTJOUNAEZPAIT-YFKPBYRVSA-N |
| XLogP | -1.07 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|