C9H14N6O2 — CID 15516211
2-[(2,6-diaminopurin-9-yl)methyl]propane-1,3-diol (PubChem CID 15516211) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[(2,6-diaminopurin-9-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(2,6-diaminopurin-9-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 15516211 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(2,6-diaminopurin-9-yl)methyl]propane-1,3-diol |
| SMILES | Nc1nc(N)c2ncn(CC(CO)CO)c2n1 |
| InChI | InChI=1S/C9H14N6O2/c10-7-6-8(14-9(11)13-7)15(4-12-6)1-5(2-16)3-17/h4-5,16-17H,1-3H2,(H4,10,11,13,14) |
| InChIKey | GKANYIYHVWIXIC-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |