C9H15N7O2 — CID 15516210
2-[(2-amino-6-hydrazinylpurin-9-yl)methyl]propane-1,3-diol (PubChem CID 15516210) has the molecular formula C9H15N7O2 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[(2-amino-6-hydrazinylpurin-9-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(2-amino-6-hydrazinylpurin-9-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 15516210 |
| Molecular Formula | C9H15N7O2 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-[(2-amino-6-hydrazinylpurin-9-yl)methyl]propane-1,3-diol |
| SMILES | NNc1nc(N)nc2c1ncn2CC(CO)CO |
| InChI | InChI=1S/C9H15N7O2/c10-9-13-7(15-11)6-8(14-9)16(4-12-6)1-5(2-17)3-18/h4-5,17-18H,1-3,11H2,(H3,10,13,14,15) |
| InChIKey | QHDVWXDDTREGNN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|