C10H15BrN5OS+ — CID 149091629
2-[(2-amino-6-bromopurin-9-yl)methoxy]ethyl-dimethylsulfanium (PubChem CID 149091629) has the molecular formula C10H15BrN5OS+ and a molecular weight of 333.24 g/mol. Its IUPAC name is 2-[(2-amino-6-bromopurin-9-yl)methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[(2-amino-6-bromopurin-9-yl)methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 149091629 |
| Molecular Formula | C10H15BrN5OS+ |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-[(2-amino-6-bromopurin-9-yl)methoxy]ethyl-dimethylsulfanium |
| SMILES | C[S+](C)CCOCn1cnc2c(Br)nc(N)nc21 |
| InChI | InChI=1S/C10H15BrN5OS/c1-18(2)4-3-17-6-16-5-13-7-8(11)14-10(12)15-9(7)16/h5H,3-4,6H2,1-2H3,(H2,12,14,15)/q+1 |
| InChIKey | QSMNNONYPRXCPL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|