C18H27BrN6 — CID 143429632
6-bromo-9-[(3,4,5-trimethyl-2-pyridinyl)methyl]purin-2-amine;ethane (PubChem CID 143429632) has the molecular formula C18H27BrN6 and a molecular weight of 407.36 g/mol. Its IUPAC name is 6-bromo-9-[(3,4,5-trimethyl-2-pyridinyl)methyl]purin-2-amine;ethane.
| Compound Name | 6-bromo-9-[(3,4,5-trimethyl-2-pyridinyl)methyl]purin-2-amine;ethane |
|---|---|
| PubChem CID | 143429632 |
| Molecular Formula | C18H27BrN6 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 6-bromo-9-[(3,4,5-trimethyl-2-pyridinyl)methyl]purin-2-amine;ethane |
| SMILES | CC.CC.Cc1cnc(Cn2cnc3c(Br)nc(N)nc32)c(C)c1C |
| InChI | InChI=1S/C14H15BrN6.2C2H6/c1-7-4-17-10(9(3)8(7)2)5-21-6-18-11-12(15)19-14(16)20-13(11)21;2*1-2/h4,6H,5H2,1-3H3,(H2,16,19,20);2*1-2H3 |
| InChIKey | CZCYRJLZPOWXPO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |