C13H14BrN7 — CID 163877048
9-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-6-bromopurin-2-amine (PubChem CID 163877048) has the molecular formula C13H14BrN7 and a molecular weight of 348.21 g/mol. Its IUPAC name is 9-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-6-bromopurin-2-amine.
| Compound Name | 9-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-6-bromopurin-2-amine |
|---|---|
| PubChem CID | 163877048 |
| Molecular Formula | C13H14BrN7 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 9-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-6-bromopurin-2-amine |
| SMILES | Cc1cnc(Cn2cnc3c(Br)nc(N)nc32)c(C)c1N |
| InChI | InChI=1S/C13H14BrN7/c1-6-3-17-8(7(2)9(6)15)4-21-5-18-10-11(14)19-13(16)20-12(10)21/h3,5H,4H2,1-2H3,(H2,15,17)(H2,16,19,20) |
| InChIKey | PPUHKLCLTQAPOE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |