C14H15IN6S — CID 143429725
9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]-6-iodopurin-2-amine (PubChem CID 143429725) has the molecular formula C14H15IN6S and a molecular weight of 426.29 g/mol. Its IUPAC name is 9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]-6-iodopurin-2-amine.
| Compound Name | 9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]-6-iodopurin-2-amine |
|---|---|
| PubChem CID | 143429725 |
| Molecular Formula | C14H15IN6S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 9-[(3,5-dimethyl-4-methylsulfanyl-2-pyridinyl)methyl]-6-iodopurin-2-amine |
| SMILES | CSc1c(C)cnc(Cn2cnc3c(I)nc(N)nc32)c1C |
| InChI | InChI=1S/C14H15IN6S/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21/h4,6H,5H2,1-3H3,(H2,16,19,20) |
| InChIKey | WVPSNTHCVCBRIT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|