C16H16BrN3 — CID 103182727
2-[(5-bromoindol-1-yl)methyl]-3,5-dimethylpyridin-4-amine (PubChem CID 103182727) has the molecular formula C16H16BrN3 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[(5-bromoindol-1-yl)methyl]-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-[(5-bromoindol-1-yl)methyl]-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103182727 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-[(5-bromoindol-1-yl)methyl]-3,5-dimethylpyridin-4-amine |
| SMILES | Cc1cnc(Cn2ccc3cc(Br)ccc32)c(C)c1N |
| InChI | InChI=1S/C16H16BrN3/c1-10-8-19-14(11(2)16(10)18)9-20-6-5-12-7-13(17)3-4-15(12)20/h3-8H,9H2,1-2H3,(H2,18,19) |
| InChIKey | NIPJJAZJBKTOHH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |