C18H18BrN — CID 116619570
5-bromo-1-[(2,4,6-trimethylphenyl)methyl]indole (PubChem CID 116619570) has the molecular formula C18H18BrN and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-bromo-1-[(2,4,6-trimethylphenyl)methyl]indole.
| Compound Name | 5-bromo-1-[(2,4,6-trimethylphenyl)methyl]indole |
|---|---|
| PubChem CID | 116619570 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 5-bromo-1-[(2,4,6-trimethylphenyl)methyl]indole |
| SMILES | Cc1cc(C)c(Cn2ccc3cc(Br)ccc32)c(C)c1 |
| InChI | InChI=1S/C18H18BrN/c1-12-8-13(2)17(14(3)9-12)11-20-7-6-15-10-16(19)4-5-18(15)20/h4-10H,11H2,1-3H3 |
| InChIKey | IVNUQNSULMQRAL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |