C18H24BrN5O3 — CID 143021258
6-bromo-9-[(3,4,5-trimethoxy-2-methylphenyl)methyl]purin-2-amine;ethane (PubChem CID 143021258) has the molecular formula C18H24BrN5O3 and a molecular weight of 438.33 g/mol. Its IUPAC name is 6-bromo-9-[(3,4,5-trimethoxy-2-methylphenyl)methyl]purin-2-amine;ethane.
| Compound Name | 6-bromo-9-[(3,4,5-trimethoxy-2-methylphenyl)methyl]purin-2-amine;ethane |
|---|---|
| PubChem CID | 143021258 |
| Molecular Formula | C18H24BrN5O3 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 6-bromo-9-[(3,4,5-trimethoxy-2-methylphenyl)methyl]purin-2-amine;ethane |
| SMILES | CC.COc1cc(Cn2cnc3c(Br)nc(N)nc32)c(C)c(OC)c1OC |
| InChI | InChI=1S/C16H18BrN5O3.C2H6/c1-8-9(5-10(23-2)13(25-4)12(8)24-3)6-22-7-19-11-14(17)20-16(18)21-15(11)22;1-2/h5,7H,6H2,1-4H3,(H2,18,20,21);1-2H3 |
| InChIKey | QYLLBZQLIJAERC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |