C16H18ClN5O2 — CID 143429732
6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine (PubChem CID 143429732) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine |
|---|---|
| PubChem CID | 143429732 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine |
| SMILES | COc1cc(Cn2cnc3c(Cl)nc(N)nc32)c(C)c(OC)c1C |
| InChI | InChI=1S/C16H18ClN5O2/c1-8-10(5-11(23-3)9(2)13(8)24-4)6-22-7-19-12-14(17)20-16(18)21-15(12)22/h5,7H,6H2,1-4H3,(H2,18,20,21) |
| InChIKey | DIGXJEUOZSJPMU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |