C18H24ClN5O2 — CID 143429731
6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine;ethane (PubChem CID 143429731) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine;ethane.
| Compound Name | 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine;ethane |
|---|---|
| PubChem CID | 143429731 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 6-chloro-9-[(3,5-dimethoxy-2,4-dimethylphenyl)methyl]purin-2-amine;ethane |
| SMILES | CC.COc1cc(Cn2cnc3c(Cl)nc(N)nc32)c(C)c(OC)c1C |
| InChI | InChI=1S/C16H18ClN5O2.C2H6/c1-8-10(5-11(23-3)9(2)13(8)24-4)6-22-7-19-12-14(17)20-16(18)21-15(12)22;1-2/h5,7H,6H2,1-4H3,(H2,18,20,21);1-2H3 |
| InChIKey | CRQOERRIKVRUEI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |