C13H18BrN2OS+ — CID 153397614
2-[[4-(bromomethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 153397614) has the molecular formula C13H18BrN2OS+ and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[4-(bromomethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 153397614 |
| Molecular Formula | C13H18BrN2OS+ |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[[4-(bromomethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | C[S+](C)CCOCn1ccc2c(CBr)ccnc21 |
| InChI | InChI=1S/C13H18BrN2OS/c1-18(2)8-7-17-10-16-6-4-12-11(9-14)3-5-15-13(12)16/h3-6H,7-10H2,1-2H3/q+1 |
| InChIKey | KXPGMHXCYWRCHA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|