C17H35N5O3Si3 — CID 91754053
N-trimethylsilyl-6-trimethylsilyloxy-9-(2-trimethylsilyloxyethoxymethyl)purin-2-amine (PubChem CID 91754053) has the molecular formula C17H35N5O3Si3 and a molecular weight of 441.76 g/mol. Its IUPAC name is N-trimethylsilyl-6-trimethylsilyloxy-9-(2-trimethylsilyloxyethoxymethyl)purin-2-amine.
| Compound Name | N-trimethylsilyl-6-trimethylsilyloxy-9-(2-trimethylsilyloxyethoxymethyl)purin-2-amine |
|---|---|
| PubChem CID | 91754053 |
| Molecular Formula | C17H35N5O3Si3 |
| Molecular Weight | 441.76 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-trimethylsilyl-6-trimethylsilyloxy-9-(2-trimethylsilyloxyethoxymethyl)purin-2-amine |
| SMILES | C[Si](C)(C)Nc1nc(O[Si](C)(C)C)c2ncn(COCCO[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C17H35N5O3Si3/c1-26(2,3)21-17-19-15-14(16(20-17)25-28(7,8)9)18-12-22(15)13-23-10-11-24-27(4,5)6/h12H,10-11,13H2,1-9H3,(H,19,20,21) |
| InChIKey | CIIRNLKDVGGHFV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|