C21H32N8O2Si — CID 140943254
2-[4-[[6-ethoxy-9-(2-trimethylsilylethoxymethyl)purin-2-yl]amino]-3-methylpyrazol-1-yl]-2-methylpropanenitrile (PubChem CID 140943254) has the molecular formula C21H32N8O2Si and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-[4-[[6-ethoxy-9-(2-trimethylsilylethoxymethyl)purin-2-yl]amino]-3-methylpyrazol-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[[6-ethoxy-9-(2-trimethylsilylethoxymethyl)purin-2-yl]amino]-3-methylpyrazol-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 140943254 |
| Molecular Formula | C21H32N8O2Si |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[4-[[6-ethoxy-9-(2-trimethylsilylethoxymethyl)purin-2-yl]amino]-3-methylpyrazol-1-yl]-2-methylpropanenitrile |
| SMILES | CCOc1nc(Nc2cn(C(C)(C)C#N)nc2C)nc2c1ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H32N8O2Si/c1-8-31-19-17-18(28(13-23-17)14-30-9-10-32(5,6)7)25-20(26-19)24-16-11-29(27-15(16)2)21(3,4)12-22/h11,13H,8-10,14H2,1-7H3,(H,24,25,26) |
| InChIKey | QPJSQLNPKBOGMD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|