C28H62N5O8PSi6 — CID 6428467
bis(trimethylsilyl) [2-[2-(trimethylsilylamino)-6-trimethylsilyloxypurin-9-yl]-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-3-yl] phosphate (PubChem CID 6428467) has the molecular formula C28H62N5O8PSi6 and a molecular weight of 796.32 g/mol. Its IUPAC name is bis(trimethylsilyl) [2-[2-(trimethylsilylamino)-6-trimethylsilyloxypurin-9-yl]-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-3-yl] phosphate.
| Compound Name | bis(trimethylsilyl) [2-[2-(trimethylsilylamino)-6-trimethylsilyloxypurin-9-yl]-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 6428467 |
| Molecular Formula | C28H62N5O8PSi6 |
| Molecular Weight | 796.32 g/mol |
| Exact Mass | 795.30 |
| IUPAC Name | bis(trimethylsilyl) [2-[2-(trimethylsilylamino)-6-trimethylsilyloxypurin-9-yl]-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-3-yl] phosphate |
| SMILES | C[Si](C)(C)Nc1nc(O[Si](C)(C)C)c2ncn(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C28H62N5O8PSi6/c1-43(2,3)32-28-30-25-22(26(31-28)39-46(10,11)12)29-20-33(25)27-24(37-42(34,40-47(13,14)15)41-48(16,17)18)23(38-45(7,8)9)21(36-27)19-35-44(4,5)6/h20-21,23-24,27H,19H2,1-18H3,(H,30,31,32) |
| InChIKey | UKLITVRBLCBDLT-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.32 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|