C10H14N5O7P — CID 170376918
[2-(6-amino-2-oxo-1H-purin-9-yl)-4-(methoxymethyl)oxetan-3-yl] dihydrogen phosphate (PubChem CID 170376918) has the molecular formula C10H14N5O7P and a molecular weight of 347.22 g/mol. Its IUPAC name is [2-(6-amino-2-oxo-1H-purin-9-yl)-4-(methoxymethyl)oxetan-3-yl] dihydrogen phosphate.
| Compound Name | [2-(6-amino-2-oxo-1H-purin-9-yl)-4-(methoxymethyl)oxetan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170376918 |
| Molecular Formula | C10H14N5O7P |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [2-(6-amino-2-oxo-1H-purin-9-yl)-4-(methoxymethyl)oxetan-3-yl] dihydrogen phosphate |
| SMILES | COCC1OC(n2cnc3c(N)[nH]c(=O)nc32)C1OP(=O)(O)O |
| InChI | InChI=1S/C10H14N5O7P/c1-20-2-4-6(22-23(17,18)19)9(21-4)15-3-12-5-7(11)13-10(16)14-8(5)15/h3-4,6,9H,2H2,1H3,(H2,17,18,19)(H3,11,13,14,16) |
| InChIKey | XQZYHABCJUCYRI-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|