C22H43N5O4Si4 — CID 546002
trimethyl-[[10-trimethylsilyl-6,12-bis(trimethylsilyloxy)-14-oxa-1,3,5,8,10-pentazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,8-tetraen-13-yl]methoxy]silane (PubChem CID 546002) has the molecular formula C22H43N5O4Si4 and a molecular weight of 553.96 g/mol. Its IUPAC name is trimethyl-[[10-trimethylsilyl-6,12-bis(trimethylsilyloxy)-14-oxa-1,3,5,8,10-pentazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,8-tetraen-13-yl]methoxy]silane.
| Compound Name | trimethyl-[[10-trimethylsilyl-6,12-bis(trimethylsilyloxy)-14-oxa-1,3,5,8,10-pentazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,8-tetraen-13-yl]methoxy]silane |
|---|---|
| PubChem CID | 546002 |
| Molecular Formula | C22H43N5O4Si4 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | trimethyl-[[10-trimethylsilyl-6,12-bis(trimethylsilyloxy)-14-oxa-1,3,5,8,10-pentazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,8-tetraen-13-yl]methoxy]silane |
| SMILES | C[Si](C)(C)OCC1OC2C(C1O[Si](C)(C)C)N([Si](C)(C)C)c1nc3c(O[Si](C)(C)C)ncnc3n12 |
| InChI | InChI=1S/C22H43N5O4Si4/c1-32(2,3)27-17-18(30-34(7,8)9)15(13-28-33(4,5)6)29-21(17)26-19-16(25-22(26)27)20(24-14-23-19)31-35(10,11)12/h14-15,17-18,21H,13H2,1-12H3 |
| InChIKey | NNTZREIJWSXXHC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|