C15H29N3O5Si2 — CID 10407916
4-amino-1-[3-hydroxy-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 10407916) has the molecular formula C15H29N3O5Si2 and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-amino-1-[3-hydroxy-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3-hydroxy-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10407916 |
| Molecular Formula | C15H29N3O5Si2 |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-amino-1-[3-hydroxy-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C[Si](C)(C)OCC1OC(n2ccc(N)nc2=O)C(O)C1O[Si](C)(C)C |
| InChI | InChI=1S/C15H29N3O5Si2/c1-24(2,3)21-9-10-13(23-25(4,5)6)12(19)14(22-10)18-8-7-11(16)17-15(18)20/h7-8,10,12-14,19H,9H2,1-6H3,(H2,16,17,20) |
| InChIKey | IMIQAAVQXMOAMP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|