C25H54N5O6PSi5 — CID 91750512
9-[(3R,4S,5S)-4-bis(trimethylsilyloxy)phosphoryl-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilylpurin-6-amine (PubChem CID 91750512) has the molecular formula C25H54N5O6PSi5 and a molecular weight of 692.14 g/mol. Its IUPAC name is 9-[(3R,4S,5S)-4-bis(trimethylsilyloxy)phosphoryl-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilylpurin-6-amine.
| Compound Name | 9-[(3R,4S,5S)-4-bis(trimethylsilyloxy)phosphoryl-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilylpurin-6-amine |
|---|---|
| PubChem CID | 91750512 |
| Molecular Formula | C25H54N5O6PSi5 |
| Molecular Weight | 692.14 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 9-[(3R,4S,5S)-4-bis(trimethylsilyloxy)phosphoryl-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilylpurin-6-amine |
| SMILES | C[Si](C)(C)Nc1ncnc2c1ncn2C1O[C@@H](CO[Si](C)(C)C)[C@H](P(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C25H54N5O6PSi5/c1-38(2,3)29-23-20-24(27-17-26-23)30(18-28-20)25-21(34-40(7,8)9)22(19(33-25)16-32-39(4,5)6)37(31,35-41(10,11)12)36-42(13,14)15/h17-19,21-22,25H,16H2,1-15H3,(H,26,27,29)/t19-,21-,22-,25?/m0/s1 |
| InChIKey | LBUJHLOVLBSSMK-WTHYHGFTSA-N |
| XLogP | 7.31 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.14 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|