C21H45N3O5Si4 — CID 23401501
5-[3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-4-trimethylsilyloxypyrimidin-2-amine (PubChem CID 23401501) has the molecular formula C21H45N3O5Si4 and a molecular weight of 531.95 g/mol. Its IUPAC name is 5-[3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-4-trimethylsilyloxypyrimidin-2-amine.
| Compound Name | 5-[3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-4-trimethylsilyloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 23401501 |
| Molecular Formula | C21H45N3O5Si4 |
| Molecular Weight | 531.95 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 5-[3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-4-trimethylsilyloxypyrimidin-2-amine |
| SMILES | C[Si](C)(C)OCC1OC(c2cnc(N)nc2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C21H45N3O5Si4/c1-30(2,3)25-14-16-18(27-31(4,5)6)19(28-32(7,8)9)17(26-16)15-13-23-21(22)24-20(15)29-33(10,11)12/h13,16-19H,14H2,1-12H3,(H2,22,23,24) |
| InChIKey | ZABFQGYRNRWCCX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|