C15H18N4O2 — CID 11369668
3-(2,6-diamino-5-phenylpyrimidin-4-yl)propyl acetate (PubChem CID 11369668) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propyl acetate.
| Compound Name | 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propyl acetate |
|---|---|
| PubChem CID | 11369668 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propyl acetate |
| SMILES | CC(=O)OCCCc1nc(N)nc(N)c1-c1ccccc1 |
| InChI | InChI=1S/C15H18N4O2/c1-10(20)21-9-5-8-12-13(11-6-3-2-4-7-11)14(16)19-15(17)18-12/h2-4,6-7H,5,8-9H2,1H3,(H4,16,17,18,19) |
| InChIKey | VNBZOAOCXAFRJW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|