C21H25ClN4O — CID 155532752
6-(5-phenoxypentyl)-5-phenylpyrimidine-2,4-diamine;hydrochloride (PubChem CID 155532752) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 6-(5-phenoxypentyl)-5-phenylpyrimidine-2,4-diamine;hydrochloride.
| Compound Name | 6-(5-phenoxypentyl)-5-phenylpyrimidine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 155532752 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-(5-phenoxypentyl)-5-phenylpyrimidine-2,4-diamine;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2ccccc2)c(CCCCCOc2ccccc2)n1 |
| InChI | InChI=1S/C21H24N4O.ClH/c22-20-19(16-10-4-1-5-11-16)18(24-21(23)25-20)14-8-3-9-15-26-17-12-6-2-7-13-17;/h1-2,4-7,10-13H,3,8-9,14-15H2,(H4,22,23,24,25);1H |
| InChIKey | VFODYGRBQKXBCR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|