C15H23ClN4O3 — CID 44522577
6-methyl-5-(4-phenoxybutoxy)pyrimidine-2,4-diamine;hydrate;hydrochloride (PubChem CID 44522577) has the molecular formula C15H23ClN4O3 and a molecular weight of 342.83 g/mol. Its IUPAC name is 6-methyl-5-(4-phenoxybutoxy)pyrimidine-2,4-diamine;hydrate;hydrochloride.
| Compound Name | 6-methyl-5-(4-phenoxybutoxy)pyrimidine-2,4-diamine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 44522577 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 6-methyl-5-(4-phenoxybutoxy)pyrimidine-2,4-diamine;hydrate;hydrochloride |
| SMILES | Cc1nc(N)nc(N)c1OCCCCOc1ccccc1.Cl.O |
| InChI | InChI=1S/C15H20N4O2.ClH.H2O/c1-11-13(14(16)19-15(17)18-11)21-10-6-5-9-20-12-7-3-2-4-8-12;;/h2-4,7-8H,5-6,9-10H2,1H3,(H4,16,17,18,19);1H;1H2 |
| InChIKey | MTKYAGIBNPNFKS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|