C24H28N4O4 — CID 177378762
ethyl 4-[4-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]benzoate (PubChem CID 177378762) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 4-[4-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]benzoate.
| Compound Name | ethyl 4-[4-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 177378762 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | ethyl 4-[4-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCOc3c(N)nc(N)nc3CC)cc2)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-20-21(22(25)28-24(26)27-20)32-15-5-14-31-19-12-10-17(11-13-19)16-6-8-18(9-7-16)23(29)30-4-2/h6-13H,3-5,14-15H2,1-2H3,(H4,25,26,27,28) |
| InChIKey | UJIGCJXGPGPAHE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|