C11H13N3O2 — CID 82358377
4-(3-phenoxypropyl)-1,2,5-oxadiazol-3-amine (PubChem CID 82358377) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(3-phenoxypropyl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(3-phenoxypropyl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 82358377 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(3-phenoxypropyl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1CCCOc1ccccc1 |
| InChI | InChI=1S/C11H13N3O2/c12-11-10(13-16-14-11)7-4-8-15-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,12,14) |
| InChIKey | SYKXRVJWVCJJDT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|