C24H29ClN4O4 — CID 155552687
4-[3-[4-(2,6-diamino-5-phenylpyrimidin-4-yl)butoxy]phenoxy]butanoic acid;hydrochloride (PubChem CID 155552687) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is 4-[3-[4-(2,6-diamino-5-phenylpyrimidin-4-yl)butoxy]phenoxy]butanoic acid;hydrochloride.
| Compound Name | 4-[3-[4-(2,6-diamino-5-phenylpyrimidin-4-yl)butoxy]phenoxy]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 155552687 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-[3-[4-(2,6-diamino-5-phenylpyrimidin-4-yl)butoxy]phenoxy]butanoic acid;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2ccccc2)c(CCCCOc2cccc(OCCCC(=O)O)c2)n1 |
| InChI | InChI=1S/C24H28N4O4.ClH/c25-23-22(17-8-2-1-3-9-17)20(27-24(26)28-23)12-4-5-14-31-18-10-6-11-19(16-18)32-15-7-13-21(29)30;/h1-3,6,8-11,16H,4-5,7,12-15H2,(H,29,30)(H4,25,26,27,28);1H |
| InChIKey | RMKGZASQRNJAAJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|