C24H23BrClF3N2O2Si — CID 177312772
2-[[6-bromo-2-(8-chloroquinolin-2-yl)-5-(trifluoromethoxy)indol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 177312772) has the molecular formula C24H23BrClF3N2O2Si and a molecular weight of 571.90 g/mol. Its IUPAC name is 2-[[6-bromo-2-(8-chloroquinolin-2-yl)-5-(trifluoromethoxy)indol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-bromo-2-(8-chloroquinolin-2-yl)-5-(trifluoromethoxy)indol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177312772 |
| Molecular Formula | C24H23BrClF3N2O2Si |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | 2-[[6-bromo-2-(8-chloroquinolin-2-yl)-5-(trifluoromethoxy)indol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc3cccc(Cl)c3n2)cc2cc(OC(F)(F)F)c(Br)cc21 |
| InChI | InChI=1S/C24H23BrClF3N2O2Si/c1-34(2,3)10-9-32-14-31-20-13-17(25)22(33-24(27,28)29)12-16(20)11-21(31)19-8-7-15-5-4-6-18(26)23(15)30-19/h4-8,11-13H,9-10,14H2,1-3H3 |
| InChIKey | VVJUYZPDGPHFSJ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|