C25H28BrN3O4SSi — CID 57433530
2-[[6-bromo-5-(4-methylsulfonylphenoxy)-2-pyridin-2-ylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 57433530) has the molecular formula C25H28BrN3O4SSi and a molecular weight of 574.57 g/mol. Its IUPAC name is 2-[[6-bromo-5-(4-methylsulfonylphenoxy)-2-pyridin-2-ylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-bromo-5-(4-methylsulfonylphenoxy)-2-pyridin-2-ylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 57433530 |
| Molecular Formula | C25H28BrN3O4SSi |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 2-[[6-bromo-5-(4-methylsulfonylphenoxy)-2-pyridin-2-ylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccn2)nc2cc(Oc3ccc(S(C)(=O)=O)cc3)c(Br)cc21 |
| InChI | InChI=1S/C25H28BrN3O4SSi/c1-34(30,31)19-10-8-18(9-11-19)33-24-16-22-23(15-20(24)26)29(17-32-13-14-35(2,3)4)25(28-22)21-7-5-6-12-27-21/h5-12,15-16H,13-14,17H2,1-4H3 |
| InChIKey | XLXWIXYUUFWTNV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|