C28H33N7O4SSi — CID 67110370
2-[[5-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-6-(2H-tetrazol-5-ylmethyl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67110370) has the molecular formula C28H33N7O4SSi and a molecular weight of 591.77 g/mol. Its IUPAC name is 2-[[5-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-6-(2H-tetrazol-5-ylmethyl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-6-(2H-tetrazol-5-ylmethyl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67110370 |
| Molecular Formula | C28H33N7O4SSi |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 2-[[5-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-6-(2H-tetrazol-5-ylmethyl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)n(COCC[Si](C)(C)C)c3cc2Cc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H33N7O4SSi/c1-5-40(36,37)22-11-9-21(10-12-22)39-26-18-24-25(16-20(26)17-27-31-33-34-32-27)35(19-38-14-15-41(2,3)4)28(30-24)23-8-6-7-13-29-23/h6-13,16,18H,5,14-15,17,19H2,1-4H3,(H,31,32,33,34) |
| InChIKey | UVGDPMUEBROSEL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|