C26H29N3O5SSi — CID 150341510
4-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbaldehyde (PubChem CID 150341510) has the molecular formula C26H29N3O5SSi and a molecular weight of 523.69 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbaldehyde.
| Compound Name | 4-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 150341510 |
| Molecular Formula | C26H29N3O5SSi |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 4-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccn2)nc2c(Oc3ccc(S(C)(=O)=O)cc3)c(C=O)ccc21 |
| InChI | InChI=1S/C26H29N3O5SSi/c1-35(31,32)21-11-9-20(10-12-21)34-25-19(17-30)8-13-23-24(25)28-26(22-7-5-6-14-27-22)29(23)18-33-15-16-36(2,3)4/h5-14,17H,15-16,18H2,1-4H3 |
| InChIKey | GRUMPTOASCRAFX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|