C27H34N4O6S2Si — CID 67110964
N-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanesulfonamide (PubChem CID 67110964) has the molecular formula C27H34N4O6S2Si and a molecular weight of 602.81 g/mol. Its IUPAC name is N-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanesulfonamide.
| Compound Name | N-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67110964 |
| Molecular Formula | C27H34N4O6S2Si |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | N-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)n(COCC[Si](C)(C)C)c3cc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H34N4O6S2Si/c1-6-39(34,35)21-12-10-20(11-13-21)37-26-18-23-25(17-24(26)30-38(2,32)33)31(19-36-15-16-40(3,4)5)27(29-23)22-9-7-8-14-28-22/h7-14,17-18,30H,6,15-16,19H2,1-5H3 |
| InChIKey | OAIDSCFGVYMPDY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|