C26H31N3O5SSi — CID 67111973
[6-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol (PubChem CID 67111973) has the molecular formula C26H31N3O5SSi and a molecular weight of 525.70 g/mol. Its IUPAC name is [6-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol.
| Compound Name | [6-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 67111973 |
| Molecular Formula | C26H31N3O5SSi |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | [6-(4-methylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccn2)nc2cc(CO)c(Oc3ccc(S(C)(=O)=O)cc3)cc21 |
| InChI | InChI=1S/C26H31N3O5SSi/c1-35(31,32)21-10-8-20(9-11-21)34-25-16-24-23(15-19(25)17-30)28-26(22-7-5-6-12-27-22)29(24)18-33-13-14-36(2,3)4/h5-12,15-16,30H,13-14,17-18H2,1-4H3 |
| InChIKey | YXEWCISLGXJMCD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|