C33H36FN3O5SSi — CID 57433571
[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-(2-fluorophenyl)methanol (PubChem CID 57433571) has the molecular formula C33H36FN3O5SSi and a molecular weight of 633.82 g/mol. Its IUPAC name is [6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-(2-fluorophenyl)methanol.
| Compound Name | [6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-(2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 57433571 |
| Molecular Formula | C33H36FN3O5SSi |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | [6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-(2-fluorophenyl)methanol |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3c(cc2C(O)c2ccccc2F)nc(-c2ccccn2)n3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C33H36FN3O5SSi/c1-5-43(39,40)24-15-13-23(14-16-24)42-31-21-30-29(20-26(31)32(38)25-10-6-7-11-27(25)34)36-33(28-12-8-9-17-35-28)37(30)22-41-18-19-44(2,3)4/h6-17,20-21,32,38H,5,18-19,22H2,1-4H3 |
| InChIKey | USBZUTQKNCNJRR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|