C27H30N6O4Si — CID 67110570
[6-[[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]oxy]-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol (PubChem CID 67110570) has the molecular formula C27H30N6O4Si and a molecular weight of 530.66 g/mol. Its IUPAC name is [6-[[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]oxy]-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol.
| Compound Name | [6-[[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]oxy]-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 67110570 |
| Molecular Formula | C27H30N6O4Si |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [6-[[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]oxy]-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methanol |
| SMILES | Cc1nc(-c2ccc(Oc3cc4nc(-c5ccccn5)n(COCC[Si](C)(C)C)c4cc3CO)cn2)no1 |
| InChI | InChI=1S/C27H30N6O4Si/c1-18-30-26(32-37-18)21-9-8-20(15-29-21)36-25-14-23-24(13-19(25)16-34)33(17-35-11-12-38(2,3)4)27(31-23)22-7-5-6-10-28-22/h5-10,13-15,34H,11-12,16-17H2,1-4H3 |
| InChIKey | PJXHJJCKPNGLJD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|