C27H28BrClN4O3Si — CID 162426615
9-(4-bromophenyl)-2-chloro-6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one (PubChem CID 162426615) has the molecular formula C27H28BrClN4O3Si and a molecular weight of 599.99 g/mol. Its IUPAC name is 9-(4-bromophenyl)-2-chloro-6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one.
| Compound Name | 9-(4-bromophenyl)-2-chloro-6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one |
|---|---|
| PubChem CID | 162426615 |
| Molecular Formula | C27H28BrClN4O3Si |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | 9-(4-bromophenyl)-2-chloro-6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one |
| SMILES | Cc1cc(-c2c(-c3ccc(Br)cc3)c3c4cc(Cl)n(COCC[Si](C)(C)C)c4ncc3n(C)c2=O)on1 |
| InChI | InChI=1S/C27H28BrClN4O3Si/c1-16-12-21(36-31-16)25-23(17-6-8-18(28)9-7-17)24-19-13-22(29)33(15-35-10-11-37(3,4)5)26(19)30-14-20(24)32(2)27(25)34/h6-9,12-14H,10-11,15H2,1-5H3 |
| InChIKey | XLKOWDMNOIKARO-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 75.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|