C19H18BrCl2N7OSi — CID 19778355
2-[2-(4-bromo-2,6-dichlorophenyl)triazol-4-yl]-1-(2-trimethylsilylethoxymethyl)imidazole-4,5-dicarbonitrile (PubChem CID 19778355) has the molecular formula C19H18BrCl2N7OSi and a molecular weight of 539.30 g/mol. Its IUPAC name is 2-[2-(4-bromo-2,6-dichlorophenyl)triazol-4-yl]-1-(2-trimethylsilylethoxymethyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 2-[2-(4-bromo-2,6-dichlorophenyl)triazol-4-yl]-1-(2-trimethylsilylethoxymethyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 19778355 |
| Molecular Formula | C19H18BrCl2N7OSi |
| Molecular Weight | 539.30 g/mol |
| Exact Mass | 536.99 |
| IUPAC Name | 2-[2-(4-bromo-2,6-dichlorophenyl)triazol-4-yl]-1-(2-trimethylsilylethoxymethyl)imidazole-4,5-dicarbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cnn(-c3c(Cl)cc(Br)cc3Cl)n2)nc(C#N)c1C#N |
| InChI | InChI=1S/C19H18BrCl2N7OSi/c1-31(2,3)5-4-30-11-28-17(9-24)15(8-23)26-19(28)16-10-25-29(27-16)18-13(21)6-12(20)7-14(18)22/h6-7,10H,4-5,11H2,1-3H3 |
| InChIKey | LDDQISRHIXBYAK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 105.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|