C26H33N5O4SSi — CID 71147034
tert-butyl 3-methyl-4-[4-oxo-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)thieno[3,2-d]pyrimidin-6-yl]pyrazole-1-carboxylate (PubChem CID 71147034) has the molecular formula C26H33N5O4SSi and a molecular weight of 539.73 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[4-oxo-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)thieno[3,2-d]pyrimidin-6-yl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[4-oxo-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)thieno[3,2-d]pyrimidin-6-yl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 71147034 |
| Molecular Formula | C26H33N5O4SSi |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | tert-butyl 3-methyl-4-[4-oxo-2-pyridin-2-yl-3-(2-trimethylsilylethoxymethyl)thieno[3,2-d]pyrimidin-6-yl]pyrazole-1-carboxylate |
| SMILES | Cc1nn(C(=O)OC(C)(C)C)cc1-c1cc2nc(-c3ccccn3)n(COCC[Si](C)(C)C)c(=O)c2s1 |
| InChI | InChI=1S/C26H33N5O4SSi/c1-17-18(15-31(29-17)25(33)35-26(2,3)4)21-14-20-22(36-21)24(32)30(16-34-12-13-37(5,6)7)23(28-20)19-10-8-9-11-27-19/h8-11,14-15H,12-13,16H2,1-7H3 |
| InChIKey | AIYDSTPMPOTMKT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|