C21H33ClN2OSi2 — CID 155723207
tert-butyl-[2-[5-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]ethynyl]-dimethylsilane (PubChem CID 155723207) has the molecular formula C21H33ClN2OSi2 and a molecular weight of 421.13 g/mol. Its IUPAC name is tert-butyl-[2-[5-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]ethynyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]ethynyl]-dimethylsilane |
|---|---|
| PubChem CID | 155723207 |
| Molecular Formula | C21H33ClN2OSi2 |
| Molecular Weight | 421.13 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | tert-butyl-[2-[5-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]ethynyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C#Cc1nc2cc(Cl)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H33ClN2OSi2/c1-21(2,3)27(7,8)13-11-20-23-18-15-17(22)9-10-19(18)24(20)16-25-12-14-26(4,5)6/h9-10,15H,12,14,16H2,1-8H3 |
| InChIKey | IMWQPHSCUSMVRD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.13 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|