C37H43ClN4O3Si — CID 140807224
tert-butyl 2-[1-[5-(2-amino-5-chlorophenyl)-2-pyridinyl]-2-phenylethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate (PubChem CID 140807224) has the molecular formula C37H43ClN4O3Si and a molecular weight of 655.32 g/mol. Its IUPAC name is tert-butyl 2-[1-[5-(2-amino-5-chlorophenyl)-2-pyridinyl]-2-phenylethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate.
| Compound Name | tert-butyl 2-[1-[5-(2-amino-5-chlorophenyl)-2-pyridinyl]-2-phenylethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 140807224 |
| Molecular Formula | C37H43ClN4O3Si |
| Molecular Weight | 655.32 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | tert-butyl 2-[1-[5-(2-amino-5-chlorophenyl)-2-pyridinyl]-2-phenylethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)nc(C(Cc1ccccc1)c1ccc(-c3cc(Cl)ccc3N)cn1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C37H43ClN4O3Si/c1-37(2,3)45-36(43)26-13-17-34-33(21-26)41-35(42(34)24-44-18-19-46(4,5)6)30(20-25-10-8-7-9-11-25)32-16-12-27(23-40-32)29-22-28(38)14-15-31(29)39/h7-17,21-23,30H,18-20,24,39H2,1-6H3 |
| InChIKey | UTLWMCQMSYBVIN-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.32 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|