C29H38ClN5O4Si — CID 66938773
tert-butyl N-[(1S)-1-[4-(3-amino-1,2-benzoxazol-6-yl)-5-chloro-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-phenylethyl]carbamate (PubChem CID 66938773) has the molecular formula C29H38ClN5O4Si and a molecular weight of 584.19 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(3-amino-1,2-benzoxazol-6-yl)-5-chloro-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(3-amino-1,2-benzoxazol-6-yl)-5-chloro-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 66938773 |
| Molecular Formula | C29H38ClN5O4Si |
| Molecular Weight | 584.19 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(3-amino-1,2-benzoxazol-6-yl)-5-chloro-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)c1nc(-c2ccc3c(N)noc3c2)c(Cl)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C29H38ClN5O4Si/c1-29(2,3)38-28(36)32-22(16-19-10-8-7-9-11-19)27-33-24(20-12-13-21-23(17-20)39-34-26(21)31)25(30)35(27)18-37-14-15-40(4,5)6/h7-13,17,22H,14-16,18H2,1-6H3,(H2,31,34)(H,32,36)/t22-/m0/s1 |
| InChIKey | OZYGWTBIJJDPDF-QFIPXVFZSA-N |
| XLogP | 7.05 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.19 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|