C12H22ClN3O3Si — CID 171068685
5-(1-chloropropyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 171068685) has the molecular formula C12H22ClN3O3Si and a molecular weight of 319.87 g/mol. Its IUPAC name is 5-(1-chloropropyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 5-(1-chloropropyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 171068685 |
| Molecular Formula | C12H22ClN3O3Si |
| Molecular Weight | 319.87 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-(1-chloropropyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCC(Cl)c1nc(C(=O)O)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C12H22ClN3O3Si/c1-5-9(13)10-14-11(12(17)18)16(15-10)8-19-6-7-20(2,3)4/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | OPBNHRHDFYAWOV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|