C24H32Cl2FN5O4Si — CID 172632586
(4R)-6-chloro-1'-[5-[(1S)-1-chloropropyl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carbonyl]-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one (PubChem CID 172632586) has the molecular formula C24H32Cl2FN5O4Si and a molecular weight of 572.54 g/mol. Its IUPAC name is (4R)-6-chloro-1'-[5-[(1S)-1-chloropropyl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carbonyl]-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one.
| Compound Name | (4R)-6-chloro-1'-[5-[(1S)-1-chloropropyl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carbonyl]-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 172632586 |
| Molecular Formula | C24H32Cl2FN5O4Si |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | (4R)-6-chloro-1'-[5-[(1S)-1-chloropropyl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carbonyl]-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
| SMILES | CC[C@H](Cl)c1nc(C(=O)N2CCC[C@@]3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C24H32Cl2FN5O4Si/c1-5-15(25)20-29-21(32(30-20)14-35-11-12-37(2,3)4)22(33)31-10-6-9-24(13-31)18-17(28-23(34)36-24)8-7-16(26)19(18)27/h7-8,15H,5-6,9-14H2,1-4H3,(H,28,34)/t15-,24-/m0/s1 |
| InChIKey | PINHJHCHABDTPX-OWJWWREXSA-N |
| XLogP | 5.77 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|