C19H16ClF6N5O3 — CID 163370667
(4R)-1'-[5-amino-1-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carbonyl]-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one (PubChem CID 163370667) has the molecular formula C19H16ClF6N5O3 and a molecular weight of 511.81 g/mol. Its IUPAC name is (4R)-1'-[5-amino-1-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carbonyl]-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one.
| Compound Name | (4R)-1'-[5-amino-1-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carbonyl]-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 163370667 |
| Molecular Formula | C19H16ClF6N5O3 |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | (4R)-1'-[5-amino-1-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carbonyl]-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
| SMILES | Nc1c(C(=O)N2CCC[C@@]3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)cnn1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H16ClF6N5O3/c20-10-2-3-11-12(13(10)21)17(34-16(33)29-11)4-1-5-30(7-17)15(32)9-6-28-31(14(9)27)8-18(22,23)19(24,25)26/h2-3,6H,1,4-5,7-8,27H2,(H,29,33)/t17-/m0/s1 |
| InChIKey | AUAKGLBYESZXIN-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|