C18H17ClFN3O4 — CID 163370683
(E)-2-[(4R)-6-chloro-5-fluoro-2-oxospiro[1H-3,1-benzoxazine-4,3'-piperidine]-1'-carbonyl]-3-ethoxyprop-2-enenitrile (PubChem CID 163370683) has the molecular formula C18H17ClFN3O4 and a molecular weight of 393.80 g/mol. Its IUPAC name is (E)-2-[(4R)-6-chloro-5-fluoro-2-oxospiro[1H-3,1-benzoxazine-4,3'-piperidine]-1'-carbonyl]-3-ethoxyprop-2-enenitrile.
| Compound Name | (E)-2-[(4R)-6-chloro-5-fluoro-2-oxospiro[1H-3,1-benzoxazine-4,3'-piperidine]-1'-carbonyl]-3-ethoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 163370683 |
| Molecular Formula | C18H17ClFN3O4 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-2-[(4R)-6-chloro-5-fluoro-2-oxospiro[1H-3,1-benzoxazine-4,3'-piperidine]-1'-carbonyl]-3-ethoxyprop-2-enenitrile |
| SMILES | CCO/C=C(\C#N)C(=O)N1CCC[C@@]2(C1)OC(=O)Nc1ccc(Cl)c(F)c12 |
| InChI | InChI=1S/C18H17ClFN3O4/c1-2-26-9-11(8-21)16(24)23-7-3-6-18(10-23)14-13(22-17(25)27-18)5-4-12(19)15(14)20/h4-5,9H,2-3,6-7,10H2,1H3,(H,22,25)/b11-9+/t18-/m0/s1 |
| InChIKey | OYIZSAXXSZMFLW-CKDFRHGISA-N |
| XLogP | 3.30 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|