C29H31ClF2N4O5Si — CID 171068584
(4R)-6-chloro-5-fluoro-1'-[2-(4-fluorobenzoyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbonyl]spiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one (PubChem CID 171068584) has the molecular formula C29H31ClF2N4O5Si and a molecular weight of 617.13 g/mol. Its IUPAC name is (4R)-6-chloro-5-fluoro-1'-[2-(4-fluorobenzoyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbonyl]spiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one.
| Compound Name | (4R)-6-chloro-5-fluoro-1'-[2-(4-fluorobenzoyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbonyl]spiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 171068584 |
| Molecular Formula | C29H31ClF2N4O5Si |
| Molecular Weight | 617.13 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | (4R)-6-chloro-5-fluoro-1'-[2-(4-fluorobenzoyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbonyl]spiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)N2CCC[C@@]3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)cnc1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H31ClF2N4O5Si/c1-42(2,3)14-13-40-17-36-22(15-33-26(36)25(37)18-5-7-19(31)8-6-18)27(38)35-12-4-11-29(16-35)23-21(34-28(39)41-29)10-9-20(30)24(23)32/h5-10,15H,4,11-14,16-17H2,1-3H3,(H,34,39)/t29-/m0/s1 |
| InChIKey | PEJMHZSGSXEYGM-LJAQVGFWSA-N |
| XLogP | 6.05 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.13 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|