About 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one
4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one (PubChem CID 174780528) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one.
Molecular Properties
| Compound Name | 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one |
| PubChem CID | 174780528 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one |
| SMILES | CCC(=O)CC.N#Cc1ccc(CCC(=O)CCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O.C5H10O/c20-13-17-5-1-15(2-6-17)9-11-19(22)12-10-16-3-7-18(14-21)8-4-16;1-3-5(6)4-2/h1-8H,9-12H2;3-4H2,1-2H3 |
| InChIKey | HTRDHOCAJLLSBI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one?
The IUPAC name of 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one (CID 174780528) is 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one.
What is the SMILES notation for 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one?
The canonical SMILES for 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one is CCC(=O)CC.N#Cc1ccc(CCC(=O)CCc2ccc(C#N)cc2)cc1.
What is the InChIKey of 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one?
The InChIKey is HTRDHOCAJLLSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O.C5H10O/c20-13-17-5-1-15(2-6-17)9-11-19(22)12-10-16-3-7-18(14-21)8-4-16;1-3-5(6)4-2/h1-8H,9-12H2;3-4H2,1-2H3.
What are the key properties of 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one?
4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one has a molecular weight of 374.48 g/mol, XLogP of 4.94, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-cyanophenyl)-3-oxopentyl]benzonitrile;pentan-3-one is sourced from PubChem (CID 174780528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).