C16H23BrN2O2Si — CID 131747440
4-bromo-3-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide (PubChem CID 131747440) has the molecular formula C16H23BrN2O2Si and a molecular weight of 383.36 g/mol. Its IUPAC name is 4-bromo-3-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide.
| Compound Name | 4-bromo-3-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 131747440 |
| Molecular Formula | C16H23BrN2O2Si |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-bromo-3-methyl-1-(2-trimethylsilylethoxymethyl)indole-7-carboxamide |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c2c(C(N)=O)ccc(Br)c12 |
| InChI | InChI=1S/C16H23BrN2O2Si/c1-11-9-19(10-21-7-8-22(2,3)4)15-12(16(18)20)5-6-13(17)14(11)15/h5-6,9H,7-8,10H2,1-4H3,(H2,18,20) |
| InChIKey | GRWOXXQVPXMPMN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|