C17H26BrN3O3Si — CID 140834480
4-bromo-N,2,6-trimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxamide (PubChem CID 140834480) has the molecular formula C17H26BrN3O3Si and a molecular weight of 428.40 g/mol. Its IUPAC name is 4-bromo-N,2,6-trimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxamide.
| Compound Name | 4-bromo-N,2,6-trimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140834480 |
| Molecular Formula | C17H26BrN3O3Si |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-bromo-N,2,6-trimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(C)n(COCC[Si](C)(C)C)c2c(=O)n(C)cc(Br)c12 |
| InChI | InChI=1S/C17H26BrN3O3Si/c1-11-13(16(22)19-2)14-12(18)9-20(3)17(23)15(14)21(11)10-24-7-8-25(4,5)6/h9H,7-8,10H2,1-6H3,(H,19,22) |
| InChIKey | CQPKOEKAEHUOSR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|